C16H35NO2Si — CID 150349172
N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-propylcyclopentanamine (PubChem CID 150349172) has the molecular formula C16H35NO2Si and a molecular weight of 301.55 g/mol. Its IUPAC name is N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-propylcyclopentanamine.
| Compound Name | N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-propylcyclopentanamine |
|---|---|
| PubChem CID | 150349172 |
| Molecular Formula | C16H35NO2Si |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-propylcyclopentanamine |
| SMILES | CCCN(C1CCCC1)[Si](OC)(OC)C(C)(C)C(C)C |
| InChI | InChI=1S/C16H35NO2Si/c1-8-13-17(15-11-9-10-12-15)20(18-6,19-7)16(4,5)14(2)3/h14-15H,8-13H2,1-7H3 |
| InChIKey | GTJBVFHXEOJYAG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|