C12H26N2 — CID 43312482
2-N-cyclopentyl-2-N,3-dimethylpentane-1,2-diamine (PubChem CID 43312482) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-N-cyclopentyl-2-N,3-dimethylpentane-1,2-diamine.
| Compound Name | 2-N-cyclopentyl-2-N,3-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 43312482 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 2-N-cyclopentyl-2-N,3-dimethylpentane-1,2-diamine |
| SMILES | CCC(C)C(CN)N(C)C1CCCC1 |
| InChI | InChI=1S/C12H26N2/c1-4-10(2)12(9-13)14(3)11-7-5-6-8-11/h10-12H,4-9,13H2,1-3H3 |
| InChIKey | WELJXCITFXFETK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |