C13H30O2Si — CID 139767643
dimethoxy-propyl-(2,3,4-trimethylpentan-2-yl)silane (PubChem CID 139767643) has the molecular formula C13H30O2Si and a molecular weight of 246.47 g/mol. Its IUPAC name is dimethoxy-propyl-(2,3,4-trimethylpentan-2-yl)silane.
| Compound Name | dimethoxy-propyl-(2,3,4-trimethylpentan-2-yl)silane |
|---|---|
| PubChem CID | 139767643 |
| Molecular Formula | C13H30O2Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | dimethoxy-propyl-(2,3,4-trimethylpentan-2-yl)silane |
| SMILES | CCC[Si](OC)(OC)C(C)(C)C(C)C(C)C |
| InChI | InChI=1S/C13H30O2Si/c1-9-10-16(14-7,15-8)13(5,6)12(4)11(2)3/h11-12H,9-10H2,1-8H3 |
| InChIKey | YIORPPYCUVVPLZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|