C21H46O2Si — CID 151840194
decyl-(3-ethyl-2,4-dimethylpentan-2-yl)-dimethoxysilane (PubChem CID 151840194) has the molecular formula C21H46O2Si and a molecular weight of 358.68 g/mol. Its IUPAC name is decyl-(3-ethyl-2,4-dimethylpentan-2-yl)-dimethoxysilane.
| Compound Name | decyl-(3-ethyl-2,4-dimethylpentan-2-yl)-dimethoxysilane |
|---|---|
| PubChem CID | 151840194 |
| Molecular Formula | C21H46O2Si |
| Molecular Weight | 358.68 g/mol |
| Exact Mass | 358.33 |
| IUPAC Name | decyl-(3-ethyl-2,4-dimethylpentan-2-yl)-dimethoxysilane |
| SMILES | CCCCCCCCCC[Si](OC)(OC)C(C)(C)C(CC)C(C)C |
| InChI | InChI=1S/C21H46O2Si/c1-9-11-12-13-14-15-16-17-18-24(22-7,23-8)21(5,6)20(10-2)19(3)4/h19-20H,9-18H2,1-8H3 |
| InChIKey | SGMPAFWCGITZOV-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.68 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|