C15H34O2Si — CID 139767626
2,3-dimethylhexan-2-yl-dimethoxy-pentylsilane (PubChem CID 139767626) has the molecular formula C15H34O2Si and a molecular weight of 274.52 g/mol. Its IUPAC name is 2,3-dimethylhexan-2-yl-dimethoxy-pentylsilane.
| Compound Name | 2,3-dimethylhexan-2-yl-dimethoxy-pentylsilane |
|---|---|
| PubChem CID | 139767626 |
| Molecular Formula | C15H34O2Si |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2,3-dimethylhexan-2-yl-dimethoxy-pentylsilane |
| SMILES | CCCCC[Si](OC)(OC)C(C)(C)C(C)CCC |
| InChI | InChI=1S/C15H34O2Si/c1-8-10-11-13-18(16-6,17-7)15(4,5)14(3)12-9-2/h14H,8-13H2,1-7H3 |
| InChIKey | DIEUNHPATYBEIW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|