C14H34Si2 — CID 10848841
trimethyl-(3,4,4-trimethyl-2-trimethylsilylpentan-2-yl)silane (PubChem CID 10848841) has the molecular formula C14H34Si2 and a molecular weight of 258.60 g/mol. Its IUPAC name is trimethyl-(3,4,4-trimethyl-2-trimethylsilylpentan-2-yl)silane.
| Compound Name | trimethyl-(3,4,4-trimethyl-2-trimethylsilylpentan-2-yl)silane |
|---|---|
| PubChem CID | 10848841 |
| Molecular Formula | C14H34Si2 |
| Molecular Weight | 258.60 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | trimethyl-(3,4,4-trimethyl-2-trimethylsilylpentan-2-yl)silane |
| SMILES | CC(C(C)(C)C)C(C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H34Si2/c1-12(13(2,3)4)14(5,15(6,7)8)16(9,10)11/h12H,1-11H3 |
| InChIKey | CHGWACOKKJPDPQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|