C20H44Si — CID 91529208
tert-butyl-[2-(3,3-dimethylbutan-2-yl)-3,4,4-trimethylpentyl]-dimethylsilane (PubChem CID 91529208) has the molecular formula C20H44Si and a molecular weight of 312.66 g/mol. Its IUPAC name is tert-butyl-[2-(3,3-dimethylbutan-2-yl)-3,4,4-trimethylpentyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-(3,3-dimethylbutan-2-yl)-3,4,4-trimethylpentyl]-dimethylsilane |
|---|---|
| PubChem CID | 91529208 |
| Molecular Formula | C20H44Si |
| Molecular Weight | 312.66 g/mol |
| Exact Mass | 312.32 |
| IUPAC Name | tert-butyl-[2-(3,3-dimethylbutan-2-yl)-3,4,4-trimethylpentyl]-dimethylsilane |
| SMILES | CC(C(C[Si](C)(C)C(C)(C)C)C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H44Si/c1-15(18(3,4)5)17(16(2)19(6,7)8)14-21(12,13)20(9,10)11/h15-17H,14H2,1-13H3 |
| InChIKey | TVDRNZKIGJVSAI-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|