C16H34 — CID 90766744
2,2,3,5-tetramethyl-4-(2-methylpropyl)octane (PubChem CID 90766744) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 2,2,3,5-tetramethyl-4-(2-methylpropyl)octane.
| Compound Name | 2,2,3,5-tetramethyl-4-(2-methylpropyl)octane |
|---|---|
| PubChem CID | 90766744 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 2,2,3,5-tetramethyl-4-(2-methylpropyl)octane |
| SMILES | CCCC(C)C(CC(C)C)C(C)C(C)(C)C |
| InChI | InChI=1S/C16H34/c1-9-10-13(4)15(11-12(2)3)14(5)16(6,7)8/h12-15H,9-11H2,1-8H3 |
| InChIKey | WDBPCTHSMRTQEA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |