About 7-tert-butyl-4,5-dimethyl-8-propylundecane
7-tert-butyl-4,5-dimethyl-8-propylundecane (PubChem CID 123567067) has the molecular formula C20H42
and a molecular weight of 282.56 g/mol. Its IUPAC name is 7-tert-butyl-4,5-dimethyl-8-propylundecane.
Molecular Properties
| Compound Name | 7-tert-butyl-4,5-dimethyl-8-propylundecane |
| PubChem CID | 123567067 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 7-tert-butyl-4,5-dimethyl-8-propylundecane |
| SMILES | CCCC(C)C(C)CC(C(CCC)CCC)C(C)(C)C |
| InChI | InChI=1S/C20H42/c1-9-12-16(4)17(5)15-19(20(6,7)8)18(13-10-2)14-11-3/h16-19H,9-15H2,1-8H3 |
| InChIKey | VEEMZIYHJBEHPC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-tert-butyl-4,5-dimethyl-8-propylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4,5-dimethyl-8-propylundecane?
The IUPAC name of 7-tert-butyl-4,5-dimethyl-8-propylundecane (CID 123567067) is 7-tert-butyl-4,5-dimethyl-8-propylundecane.
What is the SMILES notation for 7-tert-butyl-4,5-dimethyl-8-propylundecane?
The canonical SMILES for 7-tert-butyl-4,5-dimethyl-8-propylundecane is CCCC(C)C(C)CC(C(CCC)CCC)C(C)(C)C.
What is the InChIKey of 7-tert-butyl-4,5-dimethyl-8-propylundecane?
The InChIKey is VEEMZIYHJBEHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42/c1-9-12-16(4)17(5)15-19(20(6,7)8)18(13-10-2)14-11-3/h16-19H,9-15H2,1-8H3.
What are the key properties of 7-tert-butyl-4,5-dimethyl-8-propylundecane?
7-tert-butyl-4,5-dimethyl-8-propylundecane has a molecular weight of 282.56 g/mol, XLogP of 7.33, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4,5-dimethyl-8-propylundecane is sourced from PubChem (CID 123567067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).