C8H11P — CID 134853757
7-methyl-7-phosphabicyclo[4.2.0]octa-2,4-diene (PubChem CID 134853757) has the molecular formula C8H11P and a molecular weight of 138.15 g/mol. Its IUPAC name is 7-methyl-7-phosphabicyclo[4.2.0]octa-2,4-diene.
| Compound Name | 7-methyl-7-phosphabicyclo[4.2.0]octa-2,4-diene |
|---|---|
| PubChem CID | 134853757 |
| Molecular Formula | C8H11P |
| Molecular Weight | 138.15 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 7-methyl-7-phosphabicyclo[4.2.0]octa-2,4-diene |
| SMILES | CP1CC2C=CC=CC21 |
| InChI | InChI=1S/C8H11P/c1-9-6-7-4-2-3-5-8(7)9/h2-5,7-8H,6H2,1H3 |
| InChIKey | MOTJRKBNIQBJNP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|