C10H16Si — CID 102320969
cyclopenta-2,4-dien-1-yl-dimethyl-[(E)-prop-1-enyl]silane (PubChem CID 102320969) has the molecular formula C10H16Si and a molecular weight of 164.32 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-dimethyl-[(E)-prop-1-enyl]silane.
| Compound Name | cyclopenta-2,4-dien-1-yl-dimethyl-[(E)-prop-1-enyl]silane |
|---|---|
| PubChem CID | 102320969 |
| Molecular Formula | C10H16Si |
| Molecular Weight | 164.32 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-dimethyl-[(E)-prop-1-enyl]silane |
| SMILES | C/C=C/[Si](C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C10H16Si/c1-4-9-11(2,3)10-7-5-6-8-10/h4-10H,1-3H3/b9-4+ |
| InChIKey | RWGUQEBFXMTJOL-RUDMXATFSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|