C14H21OSi2- — CID 24893216
cyclopenta-2,4-dien-1-yl-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 24893216) has the molecular formula C14H21OSi2- and a molecular weight of 261.49 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 24893216 |
| Molecular Formula | C14H21OSi2- |
| Molecular Weight | 261.49 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C[Si](C)(O[Si](C)(C)C1C=CC=C1)[c-]1cccc1 |
| InChI | InChI=1S/C14H21OSi2/c1-16(2,13-9-5-6-10-13)15-17(3,4)14-11-7-8-12-14/h5-13H,1-4H3/q-1 |
| InChIKey | CLVAILPBRQLDPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|