C15H30O4Si2 — CID 140798714
cyclopenta-2,4-dien-1-yl-[[diethoxy(methyl)silyl]methyl]-diethoxysilane (PubChem CID 140798714) has the molecular formula C15H30O4Si2 and a molecular weight of 330.57 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-[[diethoxy(methyl)silyl]methyl]-diethoxysilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-[[diethoxy(methyl)silyl]methyl]-diethoxysilane |
|---|---|
| PubChem CID | 140798714 |
| Molecular Formula | C15H30O4Si2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-[[diethoxy(methyl)silyl]methyl]-diethoxysilane |
| SMILES | CCO[Si](C)(C[Si](OCC)(OCC)C1C=CC=C1)OCC |
| InChI | InChI=1S/C15H30O4Si2/c1-6-16-20(5,17-7-2)14-21(18-8-3,19-9-4)15-12-10-11-13-15/h10-13,15H,6-9,14H2,1-5H3 |
| InChIKey | WCWYDEUYPWVJTI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|