C22H36O2Si — CID 100958472
di(cyclopenta-2,4-dien-1-yl)-dihexoxysilane (PubChem CID 100958472) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)-dihexoxysilane.
| Compound Name | di(cyclopenta-2,4-dien-1-yl)-dihexoxysilane |
|---|---|
| PubChem CID | 100958472 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)-dihexoxysilane |
| SMILES | CCCCCCO[Si](OCCCCCC)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C22H36O2Si/c1-3-5-7-13-19-23-25(21-15-9-10-16-21,22-17-11-12-18-22)24-20-14-8-6-4-2/h9-12,15-18,21-22H,3-8,13-14,19-20H2,1-2H3 |
| InChIKey | XFQUGRSTEYFCBR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|