C17H38O3Si4 — CID 139795542
3-cyclopenta-2,4-dien-1-ylpropyl-tris(trimethylsilyloxy)silane (PubChem CID 139795542) has the molecular formula C17H38O3Si4 and a molecular weight of 402.83 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylpropyl-tris(trimethylsilyloxy)silane.
| Compound Name | 3-cyclopenta-2,4-dien-1-ylpropyl-tris(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 139795542 |
| Molecular Formula | C17H38O3Si4 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylpropyl-tris(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](CCCC1C=CC=C1)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O3Si4/c1-21(2,3)18-24(19-22(4,5)6,20-23(7,8)9)16-12-15-17-13-10-11-14-17/h10-11,13-14,17H,12,15-16H2,1-9H3 |
| InChIKey | QMFGELSGYZONOV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|