C12H34O3SSi4 — CID 18003138
3-tris(trimethylsilyloxy)silylpropane-1-thiol (PubChem CID 18003138) has the molecular formula C12H34O3SSi4 and a molecular weight of 370.81 g/mol. Its IUPAC name is 3-tris(trimethylsilyloxy)silylpropane-1-thiol.
| Compound Name | 3-tris(trimethylsilyloxy)silylpropane-1-thiol |
|---|---|
| PubChem CID | 18003138 |
| Molecular Formula | C12H34O3SSi4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-tris(trimethylsilyloxy)silylpropane-1-thiol |
| SMILES | C[Si](C)(C)O[Si](CCCS)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H34O3SSi4/c1-17(2,3)13-20(12-10-11-16,14-18(4,5)6)15-19(7,8)9/h16H,10-12H2,1-9H3 |
| InChIKey | WMTHOCDKBFTQDR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|