C33H100O12SSi16 — CID 123325575
3-tris[[dimethyl-[2-tris(dimethylsilyloxy)silylethyl]silyl]oxy]silylpropane-1-thiol (PubChem CID 123325575) has the molecular formula C33H100O12SSi16 and a molecular weight of 1170.59 g/mol. Its IUPAC name is 3-tris[[dimethyl-[2-tris(dimethylsilyloxy)silylethyl]silyl]oxy]silylpropane-1-thiol.
| Compound Name | 3-tris[[dimethyl-[2-tris(dimethylsilyloxy)silylethyl]silyl]oxy]silylpropane-1-thiol |
|---|---|
| PubChem CID | 123325575 |
| Molecular Formula | C33H100O12SSi16 |
| Molecular Weight | 1170.59 g/mol |
| Exact Mass | 1168.32 |
| IUPAC Name | 3-tris[[dimethyl-[2-tris(dimethylsilyloxy)silylethyl]silyl]oxy]silylpropane-1-thiol |
| SMILES | C[SiH](C)O[Si](CC[Si](C)(C)O[Si](CCCS)(O[Si](C)(C)CC[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C)O[Si](C)(C)CC[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C33H100O12SSi16/c1-47(2)34-59(35-48(3)4,36-49(5)6)31-28-56(19,20)43-62(27-25-26-46,44-57(21,22)29-32-60(37-50(7)8,38-51(9)10)39-52(11)12)45-58(23,24)30-33-61(40-53(13)14,41-54(15)16)42-55(17)18/h46-55H,25-33H2,1-24H3 |
| InChIKey | FANXHPQREUWIBK-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1170.59 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|