C9H26O4Si3 — CID 15072168
dimethylsilyloxy-dimethyl-(2-trimethoxysilylethyl)silane (PubChem CID 15072168) has the molecular formula C9H26O4Si3 and a molecular weight of 282.56 g/mol. Its IUPAC name is dimethylsilyloxy-dimethyl-(2-trimethoxysilylethyl)silane.
| Compound Name | dimethylsilyloxy-dimethyl-(2-trimethoxysilylethyl)silane |
|---|---|
| PubChem CID | 15072168 |
| Molecular Formula | C9H26O4Si3 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | dimethylsilyloxy-dimethyl-(2-trimethoxysilylethyl)silane |
| SMILES | CO[Si](CC[Si](C)(C)O[SiH](C)C)(OC)OC |
| InChI | InChI=1S/C9H26O4Si3/c1-10-16(11-2,12-3)9-8-15(6,7)13-14(4)5/h14H,8-9H2,1-7H3 |
| InChIKey | BFQCAXFSZDLJSN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|