C13H40O6Si5 — CID 158182171
dimethylsilane;trimethoxy-[2-[methoxy-methyl-[methyl(trimethylsilyloxy)silyl]oxysilyl]ethyl]silane (PubChem CID 158182171) has the molecular formula C13H40O6Si5 and a molecular weight of 432.89 g/mol. Its IUPAC name is dimethylsilane;trimethoxy-[2-[methoxy-methyl-[methyl(trimethylsilyloxy)silyl]oxysilyl]ethyl]silane.
| Compound Name | dimethylsilane;trimethoxy-[2-[methoxy-methyl-[methyl(trimethylsilyloxy)silyl]oxysilyl]ethyl]silane |
|---|---|
| PubChem CID | 158182171 |
| Molecular Formula | C13H40O6Si5 |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | dimethylsilane;trimethoxy-[2-[methoxy-methyl-[methyl(trimethylsilyloxy)silyl]oxysilyl]ethyl]silane |
| SMILES | CO[Si](C)(CC[Si](OC)(OC)OC)O[SiH](C)O[Si](C)(C)C.C[SiH2]C |
| InChI | InChI=1S/C11H32O6Si4.C2H8Si/c1-12-20(9,17-18(5)16-19(6,7)8)10-11-21(13-2,14-3)15-4;1-3-2/h18H,10-11H2,1-9H3;3H2,1-2H3 |
| InChIKey | FYSOCIWIJSQTHT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|