C12H38O5Si6 — CID 158402223
trimethyl-[methyl-bis[[methyl(trimethylsilyloxy)silyl]oxy]silyl]oxysilane (PubChem CID 158402223) has the molecular formula C12H38O5Si6 and a molecular weight of 430.95 g/mol. Its IUPAC name is trimethyl-[methyl-bis[[methyl(trimethylsilyloxy)silyl]oxy]silyl]oxysilane.
| Compound Name | trimethyl-[methyl-bis[[methyl(trimethylsilyloxy)silyl]oxy]silyl]oxysilane |
|---|---|
| PubChem CID | 158402223 |
| Molecular Formula | C12H38O5Si6 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | trimethyl-[methyl-bis[[methyl(trimethylsilyloxy)silyl]oxy]silyl]oxysilane |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(O[SiH](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H38O5Si6/c1-18(13-20(3,4)5)15-23(12,17-22(9,10)11)16-19(2)14-21(6,7)8/h18-19H,1-12H3 |
| InChIKey | GYFZSWQVSMZXPI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|