C13H38O4Si5 — CID 159784278
dimethyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-propylsilyl]oxy-trimethylsilyloxysilane (PubChem CID 159784278) has the molecular formula C13H38O4Si5 and a molecular weight of 398.87 g/mol. Its IUPAC name is dimethyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-propylsilyl]oxy-trimethylsilyloxysilane.
| Compound Name | dimethyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-propylsilyl]oxy-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 159784278 |
| Molecular Formula | C13H38O4Si5 |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | dimethyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-propylsilyl]oxy-trimethylsilyloxysilane |
| SMILES | CCC[Si](C)(O[SiH](C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H38O4Si5/c1-12-13-22(11,15-18(2)14-19(3,4)5)17-21(9,10)16-20(6,7)8/h18H,12-13H2,1-11H3 |
| InChIKey | NHTHFTOTQLPTGU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|