C16H46O7Si6 — CID 123949735
tris(dimethylsilyl) [dimethyl(2-triethoxysilylethyl)silyl] silicate (PubChem CID 123949735) has the molecular formula C16H46O7Si6 and a molecular weight of 519.05 g/mol. Its IUPAC name is tris(dimethylsilyl) [dimethyl(2-triethoxysilylethyl)silyl] silicate.
| Compound Name | tris(dimethylsilyl) [dimethyl(2-triethoxysilylethyl)silyl] silicate |
|---|---|
| PubChem CID | 123949735 |
| Molecular Formula | C16H46O7Si6 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | tris(dimethylsilyl) [dimethyl(2-triethoxysilylethyl)silyl] silicate |
| SMILES | CCO[Si](CC[Si](C)(C)O[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C)(OCC)OCC |
| InChI | InChI=1S/C16H46O7Si6/c1-12-17-28(18-13-2,19-14-3)16-15-27(10,11)23-29(20-24(4)5,21-25(6)7)22-26(8)9/h24-26H,12-16H2,1-11H3 |
| InChIKey | URHHDRYJGQRDTO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|