C24H62O8Si9 — CID 58029210
CID 58029210 (PubChem CID 58029210) has the molecular formula C24H62O8Si9 and a molecular weight of 731.53 g/mol.
| Compound Name | CID 58029210 |
|---|---|
| PubChem CID | 58029210 |
| Molecular Formula | C24H62O8Si9 |
| Molecular Weight | 731.53 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | — |
| SMILES | CCC[Si](C)(C)O[Si](C)(C)CCCC[Si](C)(C)O[Si](CC[Si](C)(C)O[Si](O[Si]C)(O[Si]C)O[Si]C)(OCC)OCC |
| InChI | InChI=1S/C24H62O8Si9/c1-15-20-36(7,8)30-37(9,10)21-18-19-22-38(11,12)31-40(25-16-2,26-17-3)24-23-39(13,14)32-41(27-33-4,28-34-5)29-35-6/h15-24H2,1-14H3 |
| InChIKey | HGLFMQJESJBKGB-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|