About triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane
triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane (PubChem CID 10090451) has the molecular formula C15H40O4Si3
and a molecular weight of 368.74 g/mol. Its IUPAC name is triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 10090451 |
| Molecular Formula | C15H40O4Si3 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H22O3Si.C6H18OSi2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-8(2,3)7-9(4,5)6/h5-9H2,1-4H3;1-6H3 |
| InChIKey | WCZZBSJVNBIGSA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane (CID 10090451) is triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane is CCC[Si](OCC)(OCC)OCC.C[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane?
The InChIKey is WCZZBSJVNBIGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C6H18OSi2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-8(2,3)7-9(4,5)6/h5-9H2,1-4H3;1-6H3.
What are the key properties of triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane?
triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane has a molecular weight of 368.74 g/mol, XLogP of 5.12, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(propyl)silane;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 10090451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).