About imidazolidine;triethoxy(propyl)silane
imidazolidine;triethoxy(propyl)silane (PubChem CID 67493251) has the molecular formula C12H30N2O3Si
and a molecular weight of 278.47 g/mol. Its IUPAC name is imidazolidine;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | imidazolidine;triethoxy(propyl)silane |
| PubChem CID | 67493251 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | imidazolidine;triethoxy(propyl)silane |
| SMILES | C1CNCN1.CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C9H22O3Si.C3H8N2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-5-3-4-1/h5-9H2,1-4H3;4-5H,1-3H2 |
| InChIKey | KDZAVFKRKQMGQY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine;triethoxy(propyl)silane?
The IUPAC name of imidazolidine;triethoxy(propyl)silane (CID 67493251) is imidazolidine;triethoxy(propyl)silane.
What is the SMILES notation for imidazolidine;triethoxy(propyl)silane?
The canonical SMILES for imidazolidine;triethoxy(propyl)silane is C1CNCN1.CCC[Si](OCC)(OCC)OCC.
What is the InChIKey of imidazolidine;triethoxy(propyl)silane?
The InChIKey is KDZAVFKRKQMGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C3H8N2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-5-3-4-1/h5-9H2,1-4H3;4-5H,1-3H2.
What are the key properties of imidazolidine;triethoxy(propyl)silane?
imidazolidine;triethoxy(propyl)silane has a molecular weight of 278.47 g/mol, XLogP of 1.58, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine;triethoxy(propyl)silane is sourced from PubChem (CID 67493251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).