About silane;3-trimethoxysilylpropane-1-thiol
silane;3-trimethoxysilylpropane-1-thiol (PubChem CID 157336747) has the molecular formula C6H20O3SSi2
and a molecular weight of 228.46 g/mol. Its IUPAC name is silane;3-trimethoxysilylpropane-1-thiol.
Molecular Properties
| Compound Name | silane;3-trimethoxysilylpropane-1-thiol |
| PubChem CID | 157336747 |
| Molecular Formula | C6H20O3SSi2 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | silane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[Si](CCCS)(OC)OC.[SiH4] |
| InChI | InChI=1S/C6H16O3SSi.H4Si/c1-7-11(8-2,9-3)6-4-5-10;/h10H,4-6H2,1-3H3;1H4 |
| InChIKey | BFXRJTDKPLPXSK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze silane;3-trimethoxysilylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;3-trimethoxysilylpropane-1-thiol?
The IUPAC name of silane;3-trimethoxysilylpropane-1-thiol (CID 157336747) is silane;3-trimethoxysilylpropane-1-thiol.
What is the SMILES notation for silane;3-trimethoxysilylpropane-1-thiol?
The canonical SMILES for silane;3-trimethoxysilylpropane-1-thiol is CO[Si](CCCS)(OC)OC.[SiH4].
What is the InChIKey of silane;3-trimethoxysilylpropane-1-thiol?
The InChIKey is BFXRJTDKPLPXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3SSi.H4Si/c1-7-11(8-2,9-3)6-4-5-10;/h10H,4-6H2,1-3H3;1H4.
What are the key properties of silane;3-trimethoxysilylpropane-1-thiol?
silane;3-trimethoxysilylpropane-1-thiol has a molecular weight of 228.46 g/mol, XLogP of -0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silane;3-trimethoxysilylpropane-1-thiol is sourced from PubChem (CID 157336747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).