C14H34O5S2Si — CID 157162585
5,5-dimethoxyhexane-1-thiol;3-trimethoxysilylpropane-1-thiol (PubChem CID 157162585) has the molecular formula C14H34O5S2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is 5,5-dimethoxyhexane-1-thiol;3-trimethoxysilylpropane-1-thiol.
| Compound Name | 5,5-dimethoxyhexane-1-thiol;3-trimethoxysilylpropane-1-thiol |
|---|---|
| PubChem CID | 157162585 |
| Molecular Formula | C14H34O5S2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5,5-dimethoxyhexane-1-thiol;3-trimethoxysilylpropane-1-thiol |
| SMILES | COC(C)(CCCCS)OC.CO[Si](CCCS)(OC)OC |
| InChI | InChI=1S/C8H18O2S.C6H16O3SSi/c1-8(9-2,10-3)6-4-5-7-11;1-7-11(8-2,9-3)6-4-5-10/h11H,4-7H2,1-3H3;10H,4-6H2,1-3H3 |
| InChIKey | AMNVINVVGXPJOM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|