About 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol
3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol (PubChem CID 88693959) has the molecular formula C9H22O5S2Si
and a molecular weight of 302.49 g/mol. Its IUPAC name is 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol.
Molecular Properties
| Compound Name | 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol |
| PubChem CID | 88693959 |
| Molecular Formula | C9H22O5S2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[Si](CCCS)(OC)OC.O=C(O)CCS |
| InChI | InChI=1S/C6H16O3SSi.C3H6O2S/c1-7-11(8-2,9-3)6-4-5-10;4-3(5)1-2-6/h10H,4-6H2,1-3H3;6H,1-2H2,(H,4,5) |
| InChIKey | QBKQWPJTVSURSK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol?
The IUPAC name of 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol (CID 88693959) is 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol.
What is the SMILES notation for 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol?
The canonical SMILES for 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol is CO[Si](CCCS)(OC)OC.O=C(O)CCS.
What is the InChIKey of 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol?
The InChIKey is QBKQWPJTVSURSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3SSi.C3H6O2S/c1-7-11(8-2,9-3)6-4-5-10;4-3(5)1-2-6/h10H,4-6H2,1-3H3;6H,1-2H2,(H,4,5).
What are the key properties of 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol?
3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol has a molecular weight of 302.49 g/mol, XLogP of 1.58, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpropanoic acid;3-trimethoxysilylpropane-1-thiol is sourced from PubChem (CID 88693959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).