C7H16O5Si — CID 175956620
2,2-dideuterio-4-trimethoxysilylbutanoic acid (PubChem CID 175956620) has the molecular formula C7H16O5Si and a molecular weight of 210.30 g/mol. Its IUPAC name is 2,2-dideuterio-4-trimethoxysilylbutanoic acid.
| Compound Name | 2,2-dideuterio-4-trimethoxysilylbutanoic acid |
|---|---|
| PubChem CID | 175956620 |
| Molecular Formula | C7H16O5Si |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,2-dideuterio-4-trimethoxysilylbutanoic acid |
| SMILES | [2H]C([2H])(CC[Si](OC)(OC)OC)C(=O)O |
| InChI | InChI=1S/C7H16O5Si/c1-10-13(11-2,12-3)6-4-5-7(8)9/h4-6H2,1-3H3,(H,8,9)/i5D2 |
| InChIKey | VKVJAWNFDVEVBK-BFWBPSQCSA-N |
| XLogP | 0.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|