About methoxysilane;3-trimethoxysilylpropane-1-thiol
methoxysilane;3-trimethoxysilylpropane-1-thiol (PubChem CID 159282463) has the molecular formula C7H22O4SSi2
and a molecular weight of 258.49 g/mol. Its IUPAC name is methoxysilane;3-trimethoxysilylpropane-1-thiol.
Molecular Properties
| Compound Name | methoxysilane;3-trimethoxysilylpropane-1-thiol |
| PubChem CID | 159282463 |
| Molecular Formula | C7H22O4SSi2 |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methoxysilane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[SiH3].CO[Si](CCCS)(OC)OC |
| InChI | InChI=1S/C6H16O3SSi.CH6OSi/c1-7-11(8-2,9-3)6-4-5-10;1-2-3/h10H,4-6H2,1-3H3;1,3H3 |
| InChIKey | KZCCRLMKHURABJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methoxysilane;3-trimethoxysilylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxysilane;3-trimethoxysilylpropane-1-thiol?
The IUPAC name of methoxysilane;3-trimethoxysilylpropane-1-thiol (CID 159282463) is methoxysilane;3-trimethoxysilylpropane-1-thiol.
What is the SMILES notation for methoxysilane;3-trimethoxysilylpropane-1-thiol?
The canonical SMILES for methoxysilane;3-trimethoxysilylpropane-1-thiol is CO[SiH3].CO[Si](CCCS)(OC)OC.
What is the InChIKey of methoxysilane;3-trimethoxysilylpropane-1-thiol?
The InChIKey is KZCCRLMKHURABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3SSi.CH6OSi/c1-7-11(8-2,9-3)6-4-5-10;1-2-3/h10H,4-6H2,1-3H3;1,3H3.
What are the key properties of methoxysilane;3-trimethoxysilylpropane-1-thiol?
methoxysilane;3-trimethoxysilylpropane-1-thiol has a molecular weight of 258.49 g/mol, XLogP of 0.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxysilane;3-trimethoxysilylpropane-1-thiol is sourced from PubChem (CID 159282463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).