C24H61ClO6S2Si4 — CID 167567175
tert-butyl-chloro-dimethylsilane;tert-butyl-dimethyl-(3-trimethoxysilylpropylsulfanyl)silane;3-trimethoxysilylpropane-1-thiol (PubChem CID 167567175) has the molecular formula C24H61ClO6S2Si4 and a molecular weight of 657.68 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;tert-butyl-dimethyl-(3-trimethoxysilylpropylsulfanyl)silane;3-trimethoxysilylpropane-1-thiol.
| Compound Name | tert-butyl-chloro-dimethylsilane;tert-butyl-dimethyl-(3-trimethoxysilylpropylsulfanyl)silane;3-trimethoxysilylpropane-1-thiol |
|---|---|
| PubChem CID | 167567175 |
| Molecular Formula | C24H61ClO6S2Si4 |
| Molecular Weight | 657.68 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;tert-butyl-dimethyl-(3-trimethoxysilylpropylsulfanyl)silane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CC(C)(C)[Si](C)(C)Cl.CO[Si](CCCS)(OC)OC.CO[Si](CCCS[Si](C)(C)C(C)(C)C)(OC)OC |
| InChI | InChI=1S/C12H30O3SSi2.C6H15ClSi.C6H16O3SSi/c1-12(2,3)17(7,8)16-10-9-11-18(13-4,14-5)15-6;1-6(2,3)8(4,5)7;1-7-11(8-2,9-3)6-4-5-10/h9-11H2,1-8H3;1-5H3;10H,4-6H2,1-3H3 |
| InChIKey | FKYIOFVKSSMGGF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|