About tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane
tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane (PubChem CID 159104117) has the molecular formula C12H32O3SSi2
and a molecular weight of 312.62 g/mol. Its IUPAC name is tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane.
Molecular Properties
| Compound Name | tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane |
| PubChem CID | 159104117 |
| Molecular Formula | C12H32O3SSi2 |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane |
| SMILES | COOC.CO[SiH2]CCCS[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H26OSSi2.C2H6O2/c1-10(2,3)14(5,6)12-8-7-9-13-11-4;1-3-4-2/h7-9,13H2,1-6H3;1-2H3 |
| InChIKey | KDQTYGFMIDNMEQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane?
The IUPAC name of tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane (CID 159104117) is tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane.
What is the SMILES notation for tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane?
The canonical SMILES for tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane is COOC.CO[SiH2]CCCS[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane?
The InChIKey is KDQTYGFMIDNMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26OSSi2.C2H6O2/c1-10(2,3)14(5,6)12-8-7-9-13-11-4;1-3-4-2/h7-9,13H2,1-6H3;1-2H3.
What are the key properties of tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane?
tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane has a molecular weight of 312.62 g/mol, XLogP of 3.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3-methoxysilylpropylsulfanyl)-dimethylsilane;methylperoxymethane is sourced from PubChem (CID 159104117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).