C23H53NO4Si2 — CID 154406577
2-(6-methoxysilylhexoxy)-N-[2-(6-methoxysilylhexoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine (PubChem CID 154406577) has the molecular formula C23H53NO4Si2 and a molecular weight of 463.85 g/mol. Its IUPAC name is 2-(6-methoxysilylhexoxy)-N-[2-(6-methoxysilylhexoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine.
| Compound Name | 2-(6-methoxysilylhexoxy)-N-[2-(6-methoxysilylhexoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 154406577 |
| Molecular Formula | C23H53NO4Si2 |
| Molecular Weight | 463.85 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 2-(6-methoxysilylhexoxy)-N-[2-(6-methoxysilylhexoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine |
| SMILES | CO[SiH2]CCCCCCOC(C)(C)CN(C)CC(C)(C)OCCCCCC[SiH2]OC |
| InChI | InChI=1S/C23H53NO4Si2/c1-22(2,27-16-12-8-10-14-18-29-25-6)20-24(5)21-23(3,4)28-17-13-9-11-15-19-30-26-7/h8-21,29-30H2,1-7H3 |
| InChIKey | GFUOZMALOAVIPY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|