C19H45NO4Si2 — CID 154406553
2-(4-methoxysilylbutoxy)-N-[2-(4-methoxysilylbutoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine (PubChem CID 154406553) has the molecular formula C19H45NO4Si2 and a molecular weight of 407.74 g/mol. Its IUPAC name is 2-(4-methoxysilylbutoxy)-N-[2-(4-methoxysilylbutoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine.
| Compound Name | 2-(4-methoxysilylbutoxy)-N-[2-(4-methoxysilylbutoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 154406553 |
| Molecular Formula | C19H45NO4Si2 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 2-(4-methoxysilylbutoxy)-N-[2-(4-methoxysilylbutoxy)-2-methylpropyl]-N,2-dimethylpropan-1-amine |
| SMILES | CO[SiH2]CCCCOC(C)(C)CN(C)CC(C)(C)OCCCC[SiH2]OC |
| InChI | InChI=1S/C19H45NO4Si2/c1-18(2,23-12-8-10-14-25-21-6)16-20(5)17-19(3,4)24-13-9-11-15-26-22-7/h8-17,25-26H2,1-7H3 |
| InChIKey | WOQAYKFIONXXQE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|