C10H26O2SSi2 — CID 175914791
tert-butyl-[[dimethoxy(methyl)silyl]methylsulfanyl]-dimethylsilane (PubChem CID 175914791) has the molecular formula C10H26O2SSi2 and a molecular weight of 266.55 g/mol. Its IUPAC name is tert-butyl-[[dimethoxy(methyl)silyl]methylsulfanyl]-dimethylsilane.
| Compound Name | tert-butyl-[[dimethoxy(methyl)silyl]methylsulfanyl]-dimethylsilane |
|---|---|
| PubChem CID | 175914791 |
| Molecular Formula | C10H26O2SSi2 |
| Molecular Weight | 266.55 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | tert-butyl-[[dimethoxy(methyl)silyl]methylsulfanyl]-dimethylsilane |
| SMILES | CO[Si](C)(CS[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C10H26O2SSi2/c1-10(2,3)14(6,7)13-9-15(8,11-4)12-5/h9H2,1-8H3 |
| InChIKey | UDHMFAIHXPOQSP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|