C18H42O2SSi2 — CID 175914800
tert-butyl-[2,2-dimethyl-3-[methyl(dipropoxy)silyl]propyl]sulfanyl-dimethylsilane (PubChem CID 175914800) has the molecular formula C18H42O2SSi2 and a molecular weight of 378.77 g/mol. Its IUPAC name is tert-butyl-[2,2-dimethyl-3-[methyl(dipropoxy)silyl]propyl]sulfanyl-dimethylsilane.
| Compound Name | tert-butyl-[2,2-dimethyl-3-[methyl(dipropoxy)silyl]propyl]sulfanyl-dimethylsilane |
|---|---|
| PubChem CID | 175914800 |
| Molecular Formula | C18H42O2SSi2 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | tert-butyl-[2,2-dimethyl-3-[methyl(dipropoxy)silyl]propyl]sulfanyl-dimethylsilane |
| SMILES | CCCO[Si](C)(CC(C)(C)CS[Si](C)(C)C(C)(C)C)OCCC |
| InChI | InChI=1S/C18H42O2SSi2/c1-11-13-19-23(10,20-14-12-2)16-18(6,7)15-21-22(8,9)17(3,4)5/h11-16H2,1-10H3 |
| InChIKey | HFCBIZRXDVLQCH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|