C30H68O6S2Si3 — CID 175914838
bis[(2,2-dimethyl-3-tripropoxysilylpropyl)sulfanyl]-dimethylsilane (PubChem CID 175914838) has the molecular formula C30H68O6S2Si3 and a molecular weight of 673.26 g/mol. Its IUPAC name is bis[(2,2-dimethyl-3-tripropoxysilylpropyl)sulfanyl]-dimethylsilane.
| Compound Name | bis[(2,2-dimethyl-3-tripropoxysilylpropyl)sulfanyl]-dimethylsilane |
|---|---|
| PubChem CID | 175914838 |
| Molecular Formula | C30H68O6S2Si3 |
| Molecular Weight | 673.26 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | bis[(2,2-dimethyl-3-tripropoxysilylpropyl)sulfanyl]-dimethylsilane |
| SMILES | CCCO[Si](CC(C)(C)CS[Si](C)(C)SCC(C)(C)C[Si](OCCC)(OCCC)OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C30H68O6S2Si3/c1-13-19-31-40(32-20-14-2,33-21-15-3)27-29(7,8)25-37-39(11,12)38-26-30(9,10)28-41(34-22-16-4,35-23-17-5)36-24-18-6/h13-28H2,1-12H3 |
| InChIKey | OMAPWUYWKRMUSO-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.26 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|