C15H14O — CID 123947483
8,8-dimethylcyclohepta[b][1]benzofuran (PubChem CID 123947483) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 8,8-dimethylcyclohepta[b][1]benzofuran.
| Compound Name | 8,8-dimethylcyclohepta[b][1]benzofuran |
|---|---|
| PubChem CID | 123947483 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 8,8-dimethylcyclohepta[b][1]benzofuran |
| SMILES | CC1(C)C=Cc2oc3ccccc3c2C=C1 |
| InChI | InChI=1S/C15H14O/c1-15(2)9-7-12-11-5-3-4-6-13(11)16-14(12)8-10-15/h3-10H,1-2H3 |
| InChIKey | PQYBSITUSNOZTB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |