C31H28N2O2 — CID 54105324
4-[3-[4-(dimethylamino)phenyl]-[1]benzofuro[3,2-f]chromen-3-yl]-N,N-dimethylaniline (PubChem CID 54105324) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]-[1]benzofuro[3,2-f]chromen-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]-[1]benzofuro[3,2-f]chromen-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54105324 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]-[1]benzofuro[3,2-f]chromen-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)C=Cc3c(ccc4oc5ccccc5c34)O2)cc1 |
| InChI | InChI=1S/C31H28N2O2/c1-32(2)23-13-9-21(10-14-23)31(22-11-15-24(16-12-22)33(3)4)20-19-26-28(35-31)17-18-29-30(26)25-7-5-6-8-27(25)34-29/h5-20H,1-4H3 |
| InChIKey | NDIKIXJBDRSENO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|