C12H11ClO — CID 151690344
5-chloro-1-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 151690344) has the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. Its IUPAC name is 5-chloro-1-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 5-chloro-1-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 151690344 |
| Molecular Formula | C12H11ClO |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 5-chloro-1-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | OC1(c2ccccc2)C=CC=C(Cl)C1 |
| InChI | InChI=1S/C12H11ClO/c13-11-7-4-8-12(14,9-11)10-5-2-1-3-6-10/h1-8,14H,9H2 |
| InChIKey | RCKQOLLJGWEKON-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |