C14H13Cl5 — CID 175064674
2,5-dichloro-5-phenylcyclohexa-1,3-diene;1,1,1-trichloroethane (PubChem CID 175064674) has the molecular formula C14H13Cl5 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2,5-dichloro-5-phenylcyclohexa-1,3-diene;1,1,1-trichloroethane.
| Compound Name | 2,5-dichloro-5-phenylcyclohexa-1,3-diene;1,1,1-trichloroethane |
|---|---|
| PubChem CID | 175064674 |
| Molecular Formula | C14H13Cl5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 2,5-dichloro-5-phenylcyclohexa-1,3-diene;1,1,1-trichloroethane |
| SMILES | CC(Cl)(Cl)Cl.ClC1=CCC(Cl)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H10Cl2.C2H3Cl3/c13-11-6-8-12(14,9-7-11)10-4-2-1-3-5-10;1-2(3,4)5/h1-8H,9H2;1H3 |
| InChIKey | JPQAZECBVDPQPE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|