C27H24F6N2O2 — CID 121435204
4-[2-(4-amino-1-phenoxycyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-phenoxycyclohexa-1,5-dien-1-amine (PubChem CID 121435204) has the molecular formula C27H24F6N2O2 and a molecular weight of 522.49 g/mol. Its IUPAC name is 4-[2-(4-amino-1-phenoxycyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-phenoxycyclohexa-1,5-dien-1-amine.
| Compound Name | 4-[2-(4-amino-1-phenoxycyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-phenoxycyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 121435204 |
| Molecular Formula | C27H24F6N2O2 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-[2-(4-amino-1-phenoxycyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-phenoxycyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCC(Oc2ccccc2)(C(C(F)(F)F)(C(F)(F)F)C2(Oc3ccccc3)C=CC(N)=CC2)C=C1 |
| InChI | InChI=1S/C27H24F6N2O2/c28-26(29,30)25(27(31,32)33,23(15-11-19(34)12-16-23)36-21-7-3-1-4-8-21)24(17-13-20(35)14-18-24)37-22-9-5-2-6-10-22/h1-15,17H,16,18,34-35H2 |
| InChIKey | VVRHWIGLZOKJIU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |