About sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine
sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 67649793) has the molecular formula C7H11F3N2O4S
and a molecular weight of 276.24 g/mol. Its IUPAC name is sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 67649793 |
| Molecular Formula | C7H11F3N2O4S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(C(F)(F)F)C=C1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H9F3N2.H2O4S/c8-7(9,10)6(12)3-1-5(11)2-4-6;1-5(2,3)4/h1-3H,4,11-12H2;(H2,1,2,3,4) |
| InChIKey | JENCKUSEGPSECU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (CID 67649793) is sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is NC1=CCC(N)(C(F)(F)F)C=C1.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The InChIKey is JENCKUSEGPSECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2.H2O4S/c8-7(9,10)6(12)3-1-5(11)2-4-6;1-5(2,3)4/h1-3H,4,11-12H2;(H2,1,2,3,4).
What are the key properties of sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine has a molecular weight of 276.24 g/mol, XLogP of 0.40, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 67649793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).