C7H11F3N2O4S — CID 67649793
sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 67649793) has the molecular formula C7H11F3N2O4S and a molecular weight of 276.24 g/mol. Its IUPAC name is sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 67649793 |
| Molecular Formula | C7H11F3N2O4S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | sulfuric acid;4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(C(F)(F)F)C=C1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H9F3N2.H2O4S/c8-7(9,10)6(12)3-1-5(11)2-4-6;1-5(2,3)4/h1-3H,4,11-12H2;(H2,1,2,3,4) |
| InChIKey | JENCKUSEGPSECU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|