About (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene
(1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene (PubChem CID 19608836) has the molecular formula C12H11FO
and a molecular weight of 190.22 g/mol. Its IUPAC name is (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene.
Molecular Properties
| Compound Name | (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene |
| PubChem CID | 19608836 |
| Molecular Formula | C12H11FO |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene |
| SMILES | FC1(Oc2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C12H11FO/c13-12(9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1,3-10H,2H2 |
| InChIKey | KINRKBWCERQKIE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene?
The IUPAC name of (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene (CID 19608836) is (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene.
What is the SMILES notation for (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene?
The canonical SMILES for (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene is FC1(Oc2ccccc2)C=CCC=C1.
What is the InChIKey of (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene?
The InChIKey is KINRKBWCERQKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FO/c13-12(9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1,3-10H,2H2.
What are the key properties of (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene?
(1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene has a molecular weight of 190.22 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene is sourced from PubChem (CID 19608836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).