C12H11FO — CID 19608836
(1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene (PubChem CID 19608836) has the molecular formula C12H11FO and a molecular weight of 190.22 g/mol. Its IUPAC name is (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene.
| Compound Name | (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene |
|---|---|
| PubChem CID | 19608836 |
| Molecular Formula | C12H11FO |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (1-fluorocyclohexa-2,5-dien-1-yl)oxybenzene |
| SMILES | FC1(Oc2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C12H11FO/c13-12(9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1,3-10H,2H2 |
| InChIKey | KINRKBWCERQKIE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|