1-phenylcyclohexa-2,5-diene-1-carboxylic acid

C13H12O2 — CID 11481068

IUPAC1-phenylcyclohexa-2,5-diene-1-carboxylic acid
SMILESO=C(O)C1(c2ccccc2)C=CCC=C1
InChIInChI=1S/C13H12O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-10H,2H2,(H,14,15)
InChIKeyPIFFRUPUXWILBW-UHFFFAOYSA-N
MW200.24 g/mol
LogP2.53
Rot. Bonds2

About 1-phenylcyclohexa-2,5-diene-1-carboxylic acid

1-phenylcyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 11481068) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-phenylcyclohexa-2,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name1-phenylcyclohexa-2,5-diene-1-carboxylic acid
PubChem CID11481068
Molecular FormulaC13H12O2
Molecular Weight200.24 g/mol
Exact Mass200.08
IUPAC Name1-phenylcyclohexa-2,5-diene-1-carboxylic acid
SMILESO=C(O)C1(c2ccccc2)C=CCC=C1
InChIInChI=1S/C13H12O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-10H,2H2,(H,14,15)
InChIKeyPIFFRUPUXWILBW-UHFFFAOYSA-N
XLogP2.53
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1-phenylcyclohexa-2,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-phenylcyclohexa-2,5-diene-1-carboxylic acid?
The IUPAC name of 1-phenylcyclohexa-2,5-diene-1-carboxylic acid (CID 11481068) is 1-phenylcyclohexa-2,5-diene-1-carboxylic acid.
What is the SMILES notation for 1-phenylcyclohexa-2,5-diene-1-carboxylic acid?
The canonical SMILES for 1-phenylcyclohexa-2,5-diene-1-carboxylic acid is O=C(O)C1(c2ccccc2)C=CCC=C1.
What is the InChIKey of 1-phenylcyclohexa-2,5-diene-1-carboxylic acid?
The InChIKey is PIFFRUPUXWILBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-10H,2H2,(H,14,15).
What are the key properties of 1-phenylcyclohexa-2,5-diene-1-carboxylic acid?
1-phenylcyclohexa-2,5-diene-1-carboxylic acid has a molecular weight of 200.24 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylcyclohexa-2,5-diene-1-carboxylic acid is sourced from PubChem (CID 11481068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).