C16H18 — CID 146167697
[1-(3,3-dideuterio-2-methylprop-2-enyl)cyclohexa-2,5-dien-1-yl]benzene (PubChem CID 146167697) has the molecular formula C16H18 and a molecular weight of 212.33 g/mol. Its IUPAC name is [1-(3,3-dideuterio-2-methylprop-2-enyl)cyclohexa-2,5-dien-1-yl]benzene.
| Compound Name | [1-(3,3-dideuterio-2-methylprop-2-enyl)cyclohexa-2,5-dien-1-yl]benzene |
|---|---|
| PubChem CID | 146167697 |
| Molecular Formula | C16H18 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [1-(3,3-dideuterio-2-methylprop-2-enyl)cyclohexa-2,5-dien-1-yl]benzene |
| SMILES | [2H]C([2H])=C(C)CC1(c2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C16H18/c1-14(2)13-16(11-7-4-8-12-16)15-9-5-3-6-10-15/h3,5-12H,1,4,13H2,2H3/i1D2 |
| InChIKey | RWVQLKUXVYRQEO-DICFDUPASA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|