C17H24O2 — CID 91103273
ethane;ethene;(1-methoxycyclohexa-2,5-dien-1-yl)oxybenzene (PubChem CID 91103273) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is ethane;ethene;(1-methoxycyclohexa-2,5-dien-1-yl)oxybenzene.
| Compound Name | ethane;ethene;(1-methoxycyclohexa-2,5-dien-1-yl)oxybenzene |
|---|---|
| PubChem CID | 91103273 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | ethane;ethene;(1-methoxycyclohexa-2,5-dien-1-yl)oxybenzene |
| SMILES | C=C.CC.COC1(Oc2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C13H14O2.C2H6.C2H4/c1-14-13(10-6-3-7-11-13)15-12-8-4-2-5-9-12;2*1-2/h2,4-11H,3H2,1H3;1-2H3;1-2H2 |
| InChIKey | NBUUPFLHAUDROY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|