C17H16O2S2 — CID 100951085
5-methylidene-2,2-diphenoxy-1,3-dithiane (PubChem CID 100951085) has the molecular formula C17H16O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-methylidene-2,2-diphenoxy-1,3-dithiane.
| Compound Name | 5-methylidene-2,2-diphenoxy-1,3-dithiane |
|---|---|
| PubChem CID | 100951085 |
| Molecular Formula | C17H16O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-methylidene-2,2-diphenoxy-1,3-dithiane |
| SMILES | C=C1CSC(Oc2ccccc2)(Oc2ccccc2)SC1 |
| InChI | InChI=1S/C17H16O2S2/c1-14-12-20-17(21-13-14,18-15-8-4-2-5-9-15)19-16-10-6-3-7-11-16/h2-11H,1,12-13H2 |
| InChIKey | BEZQZWLUIXRFNI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|