About [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene
[1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene (PubChem CID 68786800) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene.
Molecular Properties
| Compound Name | [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene |
| PubChem CID | 68786800 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene |
| SMILES | COC(OC)C1(Oc2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C15H18O3/c1-16-14(17-2)15(11-7-4-8-12-15)18-13-9-5-3-6-10-13/h3-11,14H,12H2,1-2H3 |
| InChIKey | NATPKYYVXMRWMQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene?
The IUPAC name of [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene (CID 68786800) is [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene.
What is the SMILES notation for [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene?
The canonical SMILES for [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene is COC(OC)C1(Oc2ccccc2)C=CC=CC1.
What is the InChIKey of [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene?
The InChIKey is NATPKYYVXMRWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-16-14(17-2)15(11-7-4-8-12-15)18-13-9-5-3-6-10-13/h3-11,14H,12H2,1-2H3.
What are the key properties of [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene?
[1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene has a molecular weight of 246.31 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(dimethoxymethyl)cyclohexa-2,4-dien-1-yl]oxybenzene is sourced from PubChem (CID 68786800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).