C23H26BrNO — CID 141255261
(3R,6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenylpiperidin-2-one (PubChem CID 141255261) has the molecular formula C23H26BrNO and a molecular weight of 412.37 g/mol. Its IUPAC name is (3R,6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenylpiperidin-2-one.
| Compound Name | (3R,6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 141255261 |
| Molecular Formula | C23H26BrNO |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (3R,6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenylpiperidin-2-one |
| SMILES | C=C(C)C[C@@]1(c2ccccc2)CC[C@H]([C@H](C)c2ccc(Br)cc2)C(=O)N1 |
| InChI | InChI=1S/C23H26BrNO/c1-16(2)15-23(19-7-5-4-6-8-19)14-13-21(22(26)25-23)17(3)18-9-11-20(24)12-10-18/h4-12,17,21H,1,13-15H2,2-3H3,(H,25,26)/t17-,21-,23-/m1/s1 |
| InChIKey | FGBIRGZBEMASKJ-ODOSVJCGSA-N |
| XLogP | 5.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|